![SOLVED:sin 80 + sin 40 Establish the identity tan (60) cos 80 + cos 40 Which of the following statements establishes the identity? 0A 80 40 80 + 40 80 + 40 SOLVED:sin 80 + sin 40 Establish the identity tan (60) cos 80 + cos 40 Which of the following statements establishes the identity? 0A 80 40 80 + 40 80 + 40](https://cdn.numerade.com/ask_images/3cd3b525413c4e83bbae168817184098.jpg)
SOLVED:sin 80 + sin 40 Establish the identity tan (60) cos 80 + cos 40 Which of the following statements establishes the identity? 0A 80 40 80 + 40 80 + 40
![cos40° -sin40°)/(cos40°+sin40°) = tan5° | Prove | Trigonometric Ratios of Compound Angles | Trigonometry | Sci-Pi cos40° -sin40°)/(cos40°+sin40°) = tan5° | Prove | Trigonometric Ratios of Compound Angles | Trigonometry | Sci-Pi](https://1.bp.blogspot.com/-NEIBRACjLYM/XqmitO4YJOI/AAAAAAAAJRg/Uotx-8Sxrv0CM1JS6TuRu2y2vHne5MSqACLcBGAsYHQ/s1600/IMG_20200429_173359.png)
cos40° -sin40°)/(cos40°+sin40°) = tan5° | Prove | Trigonometric Ratios of Compound Angles | Trigonometry | Sci-Pi
![Prove that: i) sin40^(@)cos50^(@)+cos40^(@)sin50^(@)=1 ii) cot(270^(@)-theta)cot(270^(@)+theta)(cot(540^(@)-theta)cot(540^(@)+theta)=1 iii) cospi/8+cos(3pi)/8+cos(5pi)/8+cos(7pi)/8=0 Prove that: i) sin40^(@)cos50^(@)+cos40^(@)sin50^(@)=1 ii) cot(270^(@)-theta)cot(270^(@)+theta)(cot(540^(@)-theta)cot(540^(@)+theta)=1 iii) cospi/8+cos(3pi)/8+cos(5pi)/8+cos(7pi)/8=0](https://d10lpgp6xz60nq.cloudfront.net/question-thumbnail/en_34798976.png)
Prove that: i) sin40^(@)cos50^(@)+cos40^(@)sin50^(@)=1 ii) cot(270^(@)-theta)cot(270^(@)+theta)(cot(540^(@)-theta)cot(540^(@)+theta)=1 iii) cospi/8+cos(3pi)/8+cos(5pi)/8+cos(7pi)/8=0
![1 prove: sin (40 +A)cos (10+A)-cos (40+A)sin (10+A)=1/2 2 evaluate: sin /12 pls send solution fast - Maths - Trigonometric Functions - 12871821 | Meritnation.com 1 prove: sin (40 +A)cos (10+A)-cos (40+A)sin (10+A)=1/2 2 evaluate: sin /12 pls send solution fast - Maths - Trigonometric Functions - 12871821 | Meritnation.com](https://s3mn.mnimgs.com/img/shared/content_ck_images/ck_5b4632d46c7c1.jpg)
1 prove: sin (40 +A)cos (10+A)-cos (40+A)sin (10+A)=1/2 2 evaluate: sin /12 pls send solution fast - Maths - Trigonometric Functions - 12871821 | Meritnation.com
![If cos (40 + A) = sin 30, the value of A is:a)60b)20c)40d)30Correct answer is option 'B'. Can you explain this answer? | EduRev Class 10 Question If cos (40 + A) = sin 30, the value of A is:a)60b)20c)40d)30Correct answer is option 'B'. Can you explain this answer? | EduRev Class 10 Question](https://cdn3.edurev.in/ApplicationImages/Temp/5655872_b8a0bb2f-d2b2-4df2-af3c-240b819d3d6d_lg.png)
If cos (40 + A) = sin 30, the value of A is:a)60b)20c)40d)30Correct answer is option 'B'. Can you explain this answer? | EduRev Class 10 Question
![What is the value of sin(10)cos(20)sin(30)cos(40)sin(50)cos(60)sin(70)cos(80)? Not in radians, in degrees. | Socratic What is the value of sin(10)cos(20)sin(30)cos(40)sin(50)cos(60)sin(70)cos(80)? Not in radians, in degrees. | Socratic](https://useruploads.socratic.org/IK25ycsASbety18tGT8x_New%20Doc%202018-01-06_1.jpg)